About 1,2-oxazole-3-carbonyl fluoride
1,2-oxazole-3-carbonyl fluoride (PubChem CID 141275558) has the molecular formula C4H2FNO2
and a molecular weight of 115.06 g/mol. Its IUPAC name is 1,2-oxazole-3-carbonyl fluoride.
Molecular Properties
| Compound Name | 1,2-oxazole-3-carbonyl fluoride |
| PubChem CID | 141275558 |
| Molecular Formula | C4H2FNO2 |
| Molecular Weight | 115.06 g/mol |
| Exact Mass | 115.01 |
| IUPAC Name | 1,2-oxazole-3-carbonyl fluoride |
| SMILES | O=C(F)c1ccon1 |
| InChI | InChI=1S/C4H2FNO2/c5-4(7)3-1-2-8-6-3/h1-2H |
| InChIKey | UCLOYCKQRFJGDF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.06 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-oxazole-3-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazole-3-carbonyl fluoride?
The IUPAC name of 1,2-oxazole-3-carbonyl fluoride (CID 141275558) is 1,2-oxazole-3-carbonyl fluoride.
What is the SMILES notation for 1,2-oxazole-3-carbonyl fluoride?
The canonical SMILES for 1,2-oxazole-3-carbonyl fluoride is O=C(F)c1ccon1.
What is the InChIKey of 1,2-oxazole-3-carbonyl fluoride?
The InChIKey is UCLOYCKQRFJGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2FNO2/c5-4(7)3-1-2-8-6-3/h1-2H.
What are the key properties of 1,2-oxazole-3-carbonyl fluoride?
1,2-oxazole-3-carbonyl fluoride has a molecular weight of 115.06 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazole-3-carbonyl fluoride is sourced from PubChem (CID 141275558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).