C13H24O2 — CID 141275596
3,3,5-triethylheptane-2,4-dione (PubChem CID 141275596) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 3,3,5-triethylheptane-2,4-dione.
| Compound Name | 3,3,5-triethylheptane-2,4-dione |
|---|---|
| PubChem CID | 141275596 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 3,3,5-triethylheptane-2,4-dione |
| SMILES | CCC(CC)C(=O)C(CC)(CC)C(C)=O |
| InChI | InChI=1S/C13H24O2/c1-6-11(7-2)12(15)13(8-3,9-4)10(5)14/h11H,6-9H2,1-5H3 |
| InChIKey | PYXWBYDVYXOSLW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|