C9H9F2N3OS — CID 141275823
N-[2-[2-(3,5-difluorophenyl)acetyl]hydrazinyl]methanethioamide (PubChem CID 141275823) has the molecular formula C9H9F2N3OS and a molecular weight of 245.25 g/mol. Its IUPAC name is N-[2-[2-(3,5-difluorophenyl)acetyl]hydrazinyl]methanethioamide.
| Compound Name | N-[2-[2-(3,5-difluorophenyl)acetyl]hydrazinyl]methanethioamide |
|---|---|
| PubChem CID | 141275823 |
| Molecular Formula | C9H9F2N3OS |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-[2-[2-(3,5-difluorophenyl)acetyl]hydrazinyl]methanethioamide |
| SMILES | O=C(Cc1cc(F)cc(F)c1)NNNC=S |
| InChI | InChI=1S/C9H9F2N3OS/c10-7-1-6(2-8(11)4-7)3-9(15)13-14-12-5-16/h1-2,4-5,14H,3H2,(H,12,16)(H,13,15) |
| InChIKey | CJRXXSREFWKSGP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|