C11H18N2O — CID 141276445
2-(cyclopropylmethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one (PubChem CID 141276445) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one.
| Compound Name | 2-(cyclopropylmethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
|---|---|
| PubChem CID | 141276445 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(cyclopropylmethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
| SMILES | O=C1CC2CN(CC3CC3)CC2CN1 |
| InChI | InChI=1S/C11H18N2O/c14-11-3-9-6-13(5-8-1-2-8)7-10(9)4-12-11/h8-10H,1-7H2,(H,12,14) |
| InChIKey | WHCAMSDIUPEIDL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |