C14H12F3NO2S — CID 141280125
N-[2-methyl-3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 141280125) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is N-[2-methyl-3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-methyl-3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141280125 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[2-methyl-3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccccc2)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO2S/c1-10-12(14(15,16)17)8-5-9-13(10)18-21(19,20)11-6-3-2-4-7-11/h2-9,18H,1H3 |
| InChIKey | HGKMHJSYWYPEDD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |