C28H22N4O2 — CID 141281225
3-(4-methylphenyl)-5-(2-oxoindol-3-yl)-N-(1-pyrazin-2-ylethyl)benzamide (PubChem CID 141281225) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-(2-oxoindol-3-yl)-N-(1-pyrazin-2-ylethyl)benzamide.
| Compound Name | 3-(4-methylphenyl)-5-(2-oxoindol-3-yl)-N-(1-pyrazin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 141281225 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3-(4-methylphenyl)-5-(2-oxoindol-3-yl)-N-(1-pyrazin-2-ylethyl)benzamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC(C)c3cnccn3)cc(C3=c4ccccc4=NC3=O)c2)cc1 |
| InChI | InChI=1S/C28H22N4O2/c1-17-7-9-19(10-8-17)20-13-21(26-23-5-3-4-6-24(23)32-28(26)34)15-22(14-20)27(33)31-18(2)25-16-29-11-12-30-25/h3-16,18H,1-2H3,(H,31,33) |
| InChIKey | AKKNNEWDGXJIFG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |