C28H32N4O2 — CID 91016091
3-[(2-cyclohexyl-2-oxoethyl)amino]-5-(4-methylphenyl)-N-(1-pyrazin-2-ylethyl)benzamide (PubChem CID 91016091) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[(2-cyclohexyl-2-oxoethyl)amino]-5-(4-methylphenyl)-N-(1-pyrazin-2-ylethyl)benzamide.
| Compound Name | 3-[(2-cyclohexyl-2-oxoethyl)amino]-5-(4-methylphenyl)-N-(1-pyrazin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 91016091 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 3-[(2-cyclohexyl-2-oxoethyl)amino]-5-(4-methylphenyl)-N-(1-pyrazin-2-ylethyl)benzamide |
| SMILES | Cc1ccc(-c2cc(NCC(=O)C3CCCCC3)cc(C(=O)NC(C)c3cnccn3)c2)cc1 |
| InChI | InChI=1S/C28H32N4O2/c1-19-8-10-21(11-9-19)23-14-24(28(34)32-20(2)26-17-29-12-13-30-26)16-25(15-23)31-18-27(33)22-6-4-3-5-7-22/h8-17,20,22,31H,3-7,18H2,1-2H3,(H,32,34) |
| InChIKey | SFUGJUZZSZPCQB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |