C29H33N3O3S — CID 175286106
3-(3-cyclopentylprop-2-enylsulfonyl)-5-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]benzamide (PubChem CID 175286106) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is 3-(3-cyclopentylprop-2-enylsulfonyl)-5-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]benzamide.
| Compound Name | 3-(3-cyclopentylprop-2-enylsulfonyl)-5-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 175286106 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 3-(3-cyclopentylprop-2-enylsulfonyl)-5-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]benzamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC(C)c3cnc(C)nc3)cc(S(=O)(=O)CC=CC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C29H33N3O3S/c1-20-10-12-24(13-11-20)25-15-26(29(33)32-21(2)27-18-30-22(3)31-19-27)17-28(16-25)36(34,35)14-6-9-23-7-4-5-8-23/h6,9-13,15-19,21,23H,4-5,7-8,14H2,1-3H3,(H,32,33) |
| InChIKey | STTUYOSFQXSQGB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|