C22H27NO4S — CID 58188299
3-cyclopentylsulfonyl-N-[(2S)-1-hydroxypropan-2-yl]-5-(4-methylphenyl)benzamide (PubChem CID 58188299) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-[(2S)-1-hydroxypropan-2-yl]-5-(4-methylphenyl)benzamide.
| Compound Name | 3-cyclopentylsulfonyl-N-[(2S)-1-hydroxypropan-2-yl]-5-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 58188299 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-[(2S)-1-hydroxypropan-2-yl]-5-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N[C@@H](C)CO)cc(S(=O)(=O)C3CCCC3)c2)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-15-7-9-17(10-8-15)18-11-19(22(25)23-16(2)14-24)13-21(12-18)28(26,27)20-5-3-4-6-20/h7-13,16,20,24H,3-6,14H2,1-2H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | ONFZNAMUXGRAMA-INIZCTEOSA-N |
| XLogP | 3.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |