C29H34N4O3S — CID 174733771
2-methyl-3-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzamide (PubChem CID 174733771) has the molecular formula C29H34N4O3S and a molecular weight of 518.68 g/mol. Its IUPAC name is 2-methyl-3-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzamide.
| Compound Name | 2-methyl-3-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzamide |
|---|---|
| PubChem CID | 174733771 |
| Molecular Formula | C29H34N4O3S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 2-methyl-3-(4-methylphenyl)-N-[1-(2-methylpyrimidin-5-yl)ethyl]-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzamide |
| SMILES | C=CC(N1CCCC1)S(=O)(=O)c1cc(C(=O)NC(C)c2cnc(C)nc2)c(C)c(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C29H34N4O3S/c1-6-28(33-13-7-8-14-33)37(35,36)25-15-26(23-11-9-19(2)10-12-23)20(3)27(16-25)29(34)32-21(4)24-17-30-22(5)31-18-24/h6,9-12,15-18,21,28H,1,7-8,13-14H2,2-5H3,(H,32,34) |
| InChIKey | HEYFXBLDYIFTKX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|