C22H25NO4S — CID 174724467
2,6-dimethyl-3-phenyl-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzoic acid (PubChem CID 174724467) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is 2,6-dimethyl-3-phenyl-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzoic acid.
| Compound Name | 2,6-dimethyl-3-phenyl-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 174724467 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2,6-dimethyl-3-phenyl-5-(1-pyrrolidin-1-ylprop-2-enylsulfonyl)benzoic acid |
| SMILES | C=CC(N1CCCC1)S(=O)(=O)c1cc(-c2ccccc2)c(C)c(C(=O)O)c1C |
| InChI | InChI=1S/C22H25NO4S/c1-4-20(23-12-8-9-13-23)28(26,27)19-14-18(17-10-6-5-7-11-17)15(2)21(16(19)3)22(24)25/h4-7,10-11,14,20H,1,8-9,12-13H2,2-3H3,(H,24,25) |
| InChIKey | KPHIKUFTVKOHSL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|