C33H57AlO3 — CID 141281626
tris[cyclobutyl-(3,3-dimethylcyclobutyl)methoxy]alumane (PubChem CID 141281626) has the molecular formula C33H57AlO3 and a molecular weight of 528.80 g/mol. Its IUPAC name is tris[cyclobutyl-(3,3-dimethylcyclobutyl)methoxy]alumane.
| Compound Name | tris[cyclobutyl-(3,3-dimethylcyclobutyl)methoxy]alumane |
|---|---|
| PubChem CID | 141281626 |
| Molecular Formula | C33H57AlO3 |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.41 |
| IUPAC Name | tris[cyclobutyl-(3,3-dimethylcyclobutyl)methoxy]alumane |
| SMILES | CC1(C)CC(C(O[Al](OC(C2CCC2)C2CC(C)(C)C2)OC(C2CCC2)C2CC(C)(C)C2)C2CCC2)C1 |
| InChI | InChI=1S/3C11H19O.Al/c3*1-11(2)6-9(7-11)10(12)8-4-3-5-8;/h3*8-10H,3-7H2,1-2H3;/q3*-1;+3 |
| InChIKey | SZEBCXRVGUZDAO-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |