C9H14BrNO3 — CID 141282400
(2R)-3-bromo-1-(2-methylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 141282400) has the molecular formula C9H14BrNO3 and a molecular weight of 264.12 g/mol. Its IUPAC name is (2R)-3-bromo-1-(2-methylpropanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-3-bromo-1-(2-methylpropanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141282400 |
| Molecular Formula | C9H14BrNO3 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | (2R)-3-bromo-1-(2-methylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C(=O)N1CCC(Br)[C@H]1C(=O)O |
| InChI | InChI=1S/C9H14BrNO3/c1-5(2)8(12)11-4-3-6(10)7(11)9(13)14/h5-7H,3-4H2,1-2H3,(H,13,14)/t6?,7-/m0/s1 |
| InChIKey | BRUIPLCCPGKMMY-MLWJPKLSSA-N |
| XLogP | 1.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|