C14H16BrF3O3S — CID 141282866
4-bromo-1-(3-ethoxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene (PubChem CID 141282866) has the molecular formula C14H16BrF3O3S and a molecular weight of 401.24 g/mol. Its IUPAC name is 4-bromo-1-(3-ethoxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene.
| Compound Name | 4-bromo-1-(3-ethoxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 141282866 |
| Molecular Formula | C14H16BrF3O3S |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 4-bromo-1-(3-ethoxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene |
| SMILES | CCOC1CCC(S(=O)(=O)c2ccc(Br)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H16BrF3O3S/c1-2-21-10-4-5-11(8-10)22(19,20)13-6-3-9(15)7-12(13)14(16,17)18/h3,6-7,10-11H,2,4-5,8H2,1H3 |
| InChIKey | QDKHGUAEDUBJHO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |