C21H17NS — CID 141284004
6-methyl-4-(4-methylphenyl)-3-phenylthieno[2,3-b]pyridine (PubChem CID 141284004) has the molecular formula C21H17NS and a molecular weight of 315.44 g/mol. Its IUPAC name is 6-methyl-4-(4-methylphenyl)-3-phenylthieno[2,3-b]pyridine.
| Compound Name | 6-methyl-4-(4-methylphenyl)-3-phenylthieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 141284004 |
| Molecular Formula | C21H17NS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 6-methyl-4-(4-methylphenyl)-3-phenylthieno[2,3-b]pyridine |
| SMILES | Cc1ccc(-c2cc(C)nc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C21H17NS/c1-14-8-10-17(11-9-14)18-12-15(2)22-21-20(18)19(13-23-21)16-6-4-3-5-7-16/h3-13H,1-2H3 |
| InChIKey | GVWGHIXCLTZIPR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |