C15H13BrN2OS — CID 82027815
3-(2-bromoethyl)-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 82027815) has the molecular formula C15H13BrN2OS and a molecular weight of 349.25 g/mol. Its IUPAC name is 3-(2-bromoethyl)-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-bromoethyl)-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82027815 |
| Molecular Formula | C15H13BrN2OS |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 3-(2-bromoethyl)-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2scc(-c3ccccc3)c2c(=O)n1CCBr |
| InChI | InChI=1S/C15H13BrN2OS/c1-10-17-14-13(15(19)18(10)8-7-16)12(9-20-14)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | YOXDXANDRPFCEP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|