C20H14N2O3S — CID 28898547
2-(4-oxo-2,5-diphenylthieno[2,3-d]pyrimidin-3-yl)acetic acid (PubChem CID 28898547) has the molecular formula C20H14N2O3S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-(4-oxo-2,5-diphenylthieno[2,3-d]pyrimidin-3-yl)acetic acid.
| Compound Name | 2-(4-oxo-2,5-diphenylthieno[2,3-d]pyrimidin-3-yl)acetic acid |
|---|---|
| PubChem CID | 28898547 |
| Molecular Formula | C20H14N2O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-(4-oxo-2,5-diphenylthieno[2,3-d]pyrimidin-3-yl)acetic acid |
| SMILES | O=C(O)Cn1c(-c2ccccc2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C20H14N2O3S/c23-16(24)11-22-18(14-9-5-2-6-10-14)21-19-17(20(22)25)15(12-26-19)13-7-3-1-4-8-13/h1-10,12H,11H2,(H,23,24) |
| InChIKey | JXZAYKBJUFDIPB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |