C20H14BrN3OS — CID 2237864
3-[(4-bromophenyl)methylideneamino]-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 2237864) has the molecular formula C20H14BrN3OS and a molecular weight of 424.32 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methylideneamino]-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(4-bromophenyl)methylideneamino]-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2237864 |
| Molecular Formula | C20H14BrN3OS |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 3-[(4-bromophenyl)methylideneamino]-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2scc(-c3ccccc3)c2c(=O)n1N=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H14BrN3OS/c1-13-23-19-18(17(12-26-19)15-5-3-2-4-6-15)20(25)24(13)22-11-14-7-9-16(21)10-8-14/h2-12H,1H3 |
| InChIKey | VAVSVSHDXLMRMK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|