C23H16N4O2S — CID 138041583
2-methyl-5-phenyl-3-[(E)-(2-phenyl-1,3-oxazol-4-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one (PubChem CID 138041583) has the molecular formula C23H16N4O2S and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-methyl-5-phenyl-3-[(E)-(2-phenyl-1,3-oxazol-4-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-methyl-5-phenyl-3-[(E)-(2-phenyl-1,3-oxazol-4-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138041583 |
| Molecular Formula | C23H16N4O2S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-methyl-5-phenyl-3-[(E)-(2-phenyl-1,3-oxazol-4-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2scc(-c3ccccc3)c2c(=O)n1/N=C/c1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H16N4O2S/c1-15-25-22-20(19(14-30-22)16-8-4-2-5-9-16)23(28)27(15)24-12-18-13-29-21(26-18)17-10-6-3-7-11-17/h2-14H,1H3/b24-12+ |
| InChIKey | KRGGLDSSEGLWFJ-WYMPLXKRSA-N |
| XLogP | 4.97 |
| TPSA | 73.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|