C23H15N3OS — CID 42993564
3-[(E)-naphthalen-2-ylmethylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 42993564) has the molecular formula C23H15N3OS and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-[(E)-naphthalen-2-ylmethylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-naphthalen-2-ylmethylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42993564 |
| Molecular Formula | C23H15N3OS |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-[(E)-naphthalen-2-ylmethylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(-c3ccccc3)csc2ncn1/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H15N3OS/c27-23-21-20(18-7-2-1-3-8-18)14-28-22(21)24-15-26(23)25-13-16-10-11-17-6-4-5-9-19(17)12-16/h1-15H/b25-13+ |
| InChIKey | YMXHPFIMPUPTPT-DHRITJCHSA-N |
| XLogP | 5.16 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|