C20H12ClF2N3O2S — CID 6893470
5-(4-chlorophenyl)-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-one (PubChem CID 6893470) has the molecular formula C20H12ClF2N3O2S and a molecular weight of 431.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-chlorophenyl)-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 6893470 |
| Molecular Formula | C20H12ClF2N3O2S |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(-c3ccc(Cl)cc3)csc2ncn1/N=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H12ClF2N3O2S/c21-14-7-5-12(6-8-14)15-10-29-18-17(15)19(27)26(11-24-18)25-9-13-3-1-2-4-16(13)28-20(22)23/h1-11,20H/b25-9+ |
| InChIKey | KAVQFCLVDJOZRK-YCPBAFNGSA-N |
| XLogP | 5.26 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|