C19H10ClN3OS — CID 46227287
12-(4-chlorophenyl)-14-thia-1,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9,11(15),12,16-heptaen-2-one (PubChem CID 46227287) has the molecular formula C19H10ClN3OS and a molecular weight of 363.83 g/mol. Its IUPAC name is 12-(4-chlorophenyl)-14-thia-1,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9,11(15),12,16-heptaen-2-one.
| Compound Name | 12-(4-chlorophenyl)-14-thia-1,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9,11(15),12,16-heptaen-2-one |
|---|---|
| PubChem CID | 46227287 |
| Molecular Formula | C19H10ClN3OS |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 12-(4-chlorophenyl)-14-thia-1,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,9,11(15),12,16-heptaen-2-one |
| SMILES | O=c1c2ccccc2nc2c3c(-c4ccc(Cl)cc4)csc3ncn12 |
| InChI | InChI=1S/C19H10ClN3OS/c20-12-7-5-11(6-8-12)14-9-25-18-16(14)17-22-15-4-2-1-3-13(15)19(24)23(17)10-21-18/h1-10H |
| InChIKey | QYRNIOHHTWQPLF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|