C16H12ClN2O3S- — CID 6922238
(2S)-2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoate (PubChem CID 6922238) has the molecular formula C16H12ClN2O3S- and a molecular weight of 347.80 g/mol. Its IUPAC name is (2S)-2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoate.
| Compound Name | (2S)-2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoate |
|---|---|
| PubChem CID | 6922238 |
| Molecular Formula | C16H12ClN2O3S- |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (2S)-2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoate |
| SMILES | CC[C@@H](C(=O)[O-])n1cnc2scc(-c3ccc(Cl)cc3)c2c1=O |
| InChI | InChI=1S/C16H13ClN2O3S/c1-2-12(16(21)22)19-8-18-14-13(15(19)20)11(7-23-14)9-3-5-10(17)6-4-9/h3-8,12H,2H2,1H3,(H,21,22)/p-1/t12-/m0/s1 |
| InChIKey | RJKZODONBJBONO-LBPRGKRZSA-M |
| XLogP | 2.48 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |