C12H13N2O3S- — CID 6929836
(2S)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate (PubChem CID 6929836) has the molecular formula C12H13N2O3S- and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate.
| Compound Name | (2S)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate |
|---|---|
| PubChem CID | 6929836 |
| Molecular Formula | C12H13N2O3S- |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (2S)-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate |
| SMILES | CC[C@@H](C(=O)[O-])n1cnc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C12H14N2O3S/c1-4-8(12(16)17)14-5-13-10-9(11(14)15)6(2)7(3)18-10/h5,8H,4H2,1-3H3,(H,16,17)/p-1/t8-/m0/s1 |
| InChIKey | XVXJHPFREIFFTJ-QMMMGPOBSA-M |
| XLogP | 0.78 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |