C19H20N2O3S — CID 4525479
benzyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate (PubChem CID 4525479) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is benzyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate.
| Compound Name | benzyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate |
|---|---|
| PubChem CID | 4525479 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | benzyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)butanoate |
| SMILES | CCC(C(=O)OCc1ccccc1)n1cnc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C19H20N2O3S/c1-4-15(19(23)24-10-14-8-6-5-7-9-14)21-11-20-17-16(18(21)22)12(2)13(3)25-17/h5-9,11,15H,4,10H2,1-3H3 |
| InChIKey | KWKRFLAKXQGGIK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |