C19H19ClN2O4S — CID 4998804
2-ethoxyethyl 2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate (PubChem CID 4998804) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate.
| Compound Name | 2-ethoxyethyl 2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
|---|---|
| PubChem CID | 4998804 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-ethoxyethyl 2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
| SMILES | CCOCCOC(=O)C(C)n1cnc2scc(-c3ccc(Cl)cc3)c2c1=O |
| InChI | InChI=1S/C19H19ClN2O4S/c1-3-25-8-9-26-19(24)12(2)22-11-21-17-16(18(22)23)15(10-27-17)13-4-6-14(20)7-5-13/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | YXIHEPDKZWXKIZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|