C20H22N2O4S — CID 4991597
2-ethoxyethyl 2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate (PubChem CID 4991597) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate.
| Compound Name | 2-ethoxyethyl 2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
|---|---|
| PubChem CID | 4991597 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-ethoxyethyl 2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
| SMILES | CCOCCOC(=O)C(C)n1cnc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C20H22N2O4S/c1-4-25-9-10-26-20(24)14(3)22-12-21-18-17(19(22)23)16(11-27-18)15-7-5-13(2)6-8-15/h5-8,11-12,14H,4,9-10H2,1-3H3 |
| InChIKey | COOXVAOIAVQHJN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|