C21H24N2O4S — CID 5192021
butyl 2-[5-(4-ethoxyphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate (PubChem CID 5192021) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is butyl 2-[5-(4-ethoxyphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate.
| Compound Name | butyl 2-[5-(4-ethoxyphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
|---|---|
| PubChem CID | 5192021 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | butyl 2-[5-(4-ethoxyphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
| SMILES | CCCCOC(=O)C(C)n1cnc2scc(-c3ccc(OCC)cc3)c2c1=O |
| InChI | InChI=1S/C21H24N2O4S/c1-4-6-11-27-21(25)14(3)23-13-22-19-18(20(23)24)17(12-28-19)15-7-9-16(10-8-15)26-5-2/h7-10,12-14H,4-6,11H2,1-3H3 |
| InChIKey | JEJWQPAUOMYCLO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|