C22H26N2O4S — CID 44636187
propyl 2-[4-oxo-5-(4-propoxyphenyl)thieno[2,3-d]pyrimidin-3-yl]butanoate (PubChem CID 44636187) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is propyl 2-[4-oxo-5-(4-propoxyphenyl)thieno[2,3-d]pyrimidin-3-yl]butanoate.
| Compound Name | propyl 2-[4-oxo-5-(4-propoxyphenyl)thieno[2,3-d]pyrimidin-3-yl]butanoate |
|---|---|
| PubChem CID | 44636187 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | propyl 2-[4-oxo-5-(4-propoxyphenyl)thieno[2,3-d]pyrimidin-3-yl]butanoate |
| SMILES | CCCOC(=O)C(CC)n1cnc2scc(-c3ccc(OCCC)cc3)c2c1=O |
| InChI | InChI=1S/C22H26N2O4S/c1-4-11-27-16-9-7-15(8-10-16)17-13-29-20-19(17)21(25)24(14-23-20)18(6-3)22(26)28-12-5-2/h7-10,13-14,18H,4-6,11-12H2,1-3H3 |
| InChIKey | DBEGBQQJFVMVLV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |