C19H15N3O4S — CID 135800382
3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 135800382) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135800382 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cccc(/C=N/n2cnc3scc(-c4ccco4)c3c2=O)c1O |
| InChI | InChI=1S/C19H15N3O4S/c1-2-25-15-6-3-5-12(17(15)23)9-21-22-11-20-18-16(19(22)24)13(10-27-18)14-7-4-8-26-14/h3-11,23H,2H2,1H3/b21-9+ |
| InChIKey | JVAXIAPXHXSRLL-ZVBGSRNCSA-N |
| XLogP | 3.70 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|