C20H23N3O2S — CID 9299038
3-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 9299038) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9299038 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-5-(furan-2-yl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)=CCC[C@H](C)C/C=N\n1cnc2scc(-c3ccco3)c2c1=O |
| InChI | InChI=1S/C20H23N3O2S/c1-14(2)6-4-7-15(3)9-10-22-23-13-21-19-18(20(23)24)16(12-26-19)17-8-5-11-25-17/h5-6,8,10-13,15H,4,7,9H2,1-3H3/b22-10-/t15-/m0/s1 |
| InChIKey | RWXOAOCXHYSNKS-ISXXMWLLSA-N |
| XLogP | 5.32 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|