C12H9N3O2S2 — CID 39159325
2-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide (PubChem CID 39159325) has the molecular formula C12H9N3O2S2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide.
| Compound Name | 2-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 39159325 |
| Molecular Formula | C12H9N3O2S2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide |
| SMILES | NC(=S)Cn1cnc2scc(-c3ccco3)c2c1=O |
| InChI | InChI=1S/C12H9N3O2S2/c13-9(18)4-15-6-14-11-10(12(15)16)7(5-19-11)8-2-1-3-17-8/h1-3,5-6H,4H2,(H2,13,18) |
| InChIKey | RQKZEJGQIQXGFO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|