C13H11N3O2S2 — CID 39776036
3-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)propanamide (PubChem CID 39776036) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)propanamide.
| Compound Name | 3-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 39776036 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)propanamide |
| SMILES | NC(=O)CCn1cnc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C13H11N3O2S2/c14-10(17)3-4-16-7-15-12-11(13(16)18)8(6-20-12)9-2-1-5-19-9/h1-2,5-7H,3-4H2,(H2,14,17) |
| InChIKey | FFDRAXMKWHLTLU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |