C14H12N2O4S — CID 28897471
4-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoic acid (PubChem CID 28897471) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoic acid.
| Compound Name | 4-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 28897471 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-[5-(furan-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cnc2scc(-c3ccco3)c2c1=O |
| InChI | InChI=1S/C14H12N2O4S/c17-11(18)4-1-5-16-8-15-13-12(14(16)19)9(7-21-13)10-3-2-6-20-10/h2-3,6-8H,1,4-5H2,(H,17,18) |
| InChIKey | VNAWGTXYUHROCA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |