C19H15N3OS — CID 9174718
6-ethyl-3-[(Z)-naphthalen-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one (PubChem CID 9174718) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is 6-ethyl-3-[(Z)-naphthalen-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-3-[(Z)-naphthalen-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9174718 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 6-ethyl-3-[(Z)-naphthalen-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(/N=C\c3ccc4ccccc4c3)cnc2s1 |
| InChI | InChI=1S/C19H15N3OS/c1-2-16-10-17-18(24-16)20-12-22(19(17)23)21-11-13-7-8-14-5-3-4-6-15(14)9-13/h3-12H,2H2,1H3/b21-11- |
| InChIKey | WUVZIZYXCHKXSR-NHDPSOOVSA-N |
| XLogP | 4.06 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|