C17H15F2N3O3S — CID 9174828
3-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 9174828) has the molecular formula C17H15F2N3O3S and a molecular weight of 379.39 g/mol. Its IUPAC name is 3-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9174828 |
| Molecular Formula | C17H15F2N3O3S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(/N=C\c3ccc(OC(F)F)c(OC)c3)cnc2s1 |
| InChI | InChI=1S/C17H15F2N3O3S/c1-3-11-7-12-15(26-11)20-9-22(16(12)23)21-8-10-4-5-13(25-17(18)19)14(6-10)24-2/h4-9,17H,3H2,1-2H3/b21-8- |
| InChIKey | NGXRUGDYHBMSRO-WNFQYIGGSA-N |
| XLogP | 3.51 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|