C30H33N3O2 — CID 141284170
[4-(2-tert-butyl-6-phenylmethoxyphenyl)piperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 141284170) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is [4-(2-tert-butyl-6-phenylmethoxyphenyl)piperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [4-(2-tert-butyl-6-phenylmethoxyphenyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 141284170 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | [4-(2-tert-butyl-6-phenylmethoxyphenyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | CC(C)(C)c1cccc(OCc2ccccc2)c1N1CCN(C(=O)c2cc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C30H33N3O2/c1-30(2,3)24-13-9-15-27(35-21-22-10-5-4-6-11-22)28(24)32-16-18-33(19-17-32)29(34)26-20-23-12-7-8-14-25(23)31-26/h4-15,20,31H,16-19,21H2,1-3H3 |
| InChIKey | FFJFBGHFPZDVRR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |