About (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate
(5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate (PubChem CID 141285465) has the molecular formula C22H25NO5
and a molecular weight of 383.44 g/mol. Its IUPAC name is (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate.
Molecular Properties
| Compound Name | (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate |
| PubChem CID | 141285465 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC2N3CCCC23c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25NO5/c1-25-17-12-15(13-18(26-2)20(17)27-3)21(24)28-14-19-22(10-7-11-23(19)22)16-8-5-4-6-9-16/h4-6,8-9,12-13,19H,7,10-11,14H2,1-3H3 |
| InChIKey | URPPYINCTWNAOR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate?
The IUPAC name of (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate (CID 141285465) is (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate.
What is the SMILES notation for (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate?
The canonical SMILES for (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate is COc1cc(C(=O)OCC2N3CCCC23c2ccccc2)cc(OC)c1OC.
What is the InChIKey of (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate?
The InChIKey is URPPYINCTWNAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO5/c1-25-17-12-15(13-18(26-2)20(17)27-3)21(24)28-14-19-22(10-7-11-23(19)22)16-8-5-4-6-9-16/h4-6,8-9,12-13,19H,7,10-11,14H2,1-3H3.
What are the key properties of (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate?
(5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate has a molecular weight of 383.44 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate is sourced from PubChem (CID 141285465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).