C22H25NO5 — CID 141285465
(5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate (PubChem CID 141285465) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate.
| Compound Name | (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 141285465 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (5-phenyl-1-azabicyclo[3.1.0]hexan-6-yl)methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC2N3CCCC23c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25NO5/c1-25-17-12-15(13-18(26-2)20(17)27-3)21(24)28-14-19-22(10-7-11-23(19)22)16-8-5-4-6-9-16/h4-6,8-9,12-13,19H,7,10-11,14H2,1-3H3 |
| InChIKey | URPPYINCTWNAOR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|