C6H8F5NO3 — CID 141285834
2,2,3,3,3-pentafluoropropyl N-(methoxymethyl)carbamate (PubChem CID 141285834) has the molecular formula C6H8F5NO3 and a molecular weight of 237.12 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl N-(methoxymethyl)carbamate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl N-(methoxymethyl)carbamate |
|---|---|
| PubChem CID | 141285834 |
| Molecular Formula | C6H8F5NO3 |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl N-(methoxymethyl)carbamate |
| SMILES | COCNC(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO3/c1-14-3-12-4(13)15-2-5(7,8)6(9,10)11/h2-3H2,1H3,(H,12,13) |
| InChIKey | XBKWCQQMFKAVLO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|