C9H3Cl4NO — CID 141287332
5,6,7,8-tetrachloro-1H-quinolin-2-one (PubChem CID 141287332) has the molecular formula C9H3Cl4NO and a molecular weight of 282.94 g/mol. Its IUPAC name is 5,6,7,8-tetrachloro-1H-quinolin-2-one.
| Compound Name | 5,6,7,8-tetrachloro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 141287332 |
| Molecular Formula | C9H3Cl4NO |
| Molecular Weight | 282.94 g/mol |
| Exact Mass | 280.90 |
| IUPAC Name | 5,6,7,8-tetrachloro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c(Cl)c(Cl)c(Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C9H3Cl4NO/c10-5-3-1-2-4(15)14-9(3)8(13)7(12)6(5)11/h1-2H,(H,14,15) |
| InChIKey | BFJXNNISPVTACK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.94 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|