C8H5NO3 — CID 87549805
8H-pyrano[2,3-b]pyridine-4,7-dione (PubChem CID 87549805) has the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. Its IUPAC name is 8H-pyrano[2,3-b]pyridine-4,7-dione.
| Compound Name | 8H-pyrano[2,3-b]pyridine-4,7-dione |
|---|---|
| PubChem CID | 87549805 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 8H-pyrano[2,3-b]pyridine-4,7-dione |
| SMILES | O=c1ccc2c(=O)ccoc2[nH]1 |
| InChI | InChI=1S/C8H5NO3/c10-6-3-4-12-8-5(6)1-2-7(11)9-8/h1-4H,(H,9,11) |
| InChIKey | RFVFERPTWASVPD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |