C11H14N2O — CID 143136262
ethane;5-methyl-1H-1,6-naphthyridin-2-one (PubChem CID 143136262) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is ethane;5-methyl-1H-1,6-naphthyridin-2-one.
| Compound Name | ethane;5-methyl-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 143136262 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | ethane;5-methyl-1H-1,6-naphthyridin-2-one |
| SMILES | CC.Cc1nccc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C9H8N2O.C2H6/c1-6-7-2-3-9(12)11-8(7)4-5-10-6;1-2/h2-5H,1H3,(H,11,12);1-2H3 |
| InChIKey | QBMUHRMXDWFLID-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |