C21H15N5O5S — CID 91242313
5-methyl-2-oxo-1H-1,6-naphthyridine-3-carbonyl isothiocyanate;5-methyl-2-oxo-1H-1,6-naphthyridine-3-carboxylic acid (PubChem CID 91242313) has the molecular formula C21H15N5O5S and a molecular weight of 449.45 g/mol. Its IUPAC name is 5-methyl-2-oxo-1H-1,6-naphthyridine-3-carbonyl isothiocyanate;5-methyl-2-oxo-1H-1,6-naphthyridine-3-carboxylic acid.
| Compound Name | 5-methyl-2-oxo-1H-1,6-naphthyridine-3-carbonyl isothiocyanate;5-methyl-2-oxo-1H-1,6-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 91242313 |
| Molecular Formula | C21H15N5O5S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 5-methyl-2-oxo-1H-1,6-naphthyridine-3-carbonyl isothiocyanate;5-methyl-2-oxo-1H-1,6-naphthyridine-3-carboxylic acid |
| SMILES | Cc1nccc2[nH]c(=O)c(C(=O)N=C=S)cc12.Cc1nccc2[nH]c(=O)c(C(=O)O)cc12 |
| InChI | InChI=1S/C11H7N3O2S.C10H8N2O3/c1-6-7-4-8(10(15)13-5-17)11(16)14-9(7)2-3-12-6;1-5-6-4-7(10(14)15)9(13)12-8(6)2-3-11-5/h2-4H,1H3,(H,14,16);2-4H,1H3,(H,12,13)(H,14,15) |
| InChIKey | CXZQOOGSCQRGHD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|