C7H8N2O2 — CID 14447106
3-amino-2-methylpyridine-4-carboxylic acid (PubChem CID 14447106) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 3-amino-2-methylpyridine-4-carboxylic acid.
| Compound Name | 3-amino-2-methylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 14447106 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 3-amino-2-methylpyridine-4-carboxylic acid |
| SMILES | Cc1nccc(C(=O)O)c1N |
| InChI | InChI=1S/C7H8N2O2/c1-4-6(8)5(7(10)11)2-3-9-4/h2-3H,8H2,1H3,(H,10,11) |
| InChIKey | DLGHJWMQPMUJTE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |