About 5-amino-1,8-naphthyridine-4-carboxylic acid
5-amino-1,8-naphthyridine-4-carboxylic acid (PubChem CID 70580977) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is 5-amino-1,8-naphthyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-1,8-naphthyridine-4-carboxylic acid |
| PubChem CID | 70580977 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 5-amino-1,8-naphthyridine-4-carboxylic acid |
| SMILES | Nc1ccnc2nccc(C(=O)O)c12 |
| InChI | InChI=1S/C9H7N3O2/c10-6-2-4-12-8-7(6)5(9(13)14)1-3-11-8/h1-4H,(H,13,14)(H2,10,11,12) |
| InChIKey | VUZTWSSCBKTAMF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-1,8-naphthyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,8-naphthyridine-4-carboxylic acid?
The IUPAC name of 5-amino-1,8-naphthyridine-4-carboxylic acid (CID 70580977) is 5-amino-1,8-naphthyridine-4-carboxylic acid.
What is the SMILES notation for 5-amino-1,8-naphthyridine-4-carboxylic acid?
The canonical SMILES for 5-amino-1,8-naphthyridine-4-carboxylic acid is Nc1ccnc2nccc(C(=O)O)c12.
What is the InChIKey of 5-amino-1,8-naphthyridine-4-carboxylic acid?
The InChIKey is VUZTWSSCBKTAMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c10-6-2-4-12-8-7(6)5(9(13)14)1-3-11-8/h1-4H,(H,13,14)(H2,10,11,12).
What are the key properties of 5-amino-1,8-naphthyridine-4-carboxylic acid?
5-amino-1,8-naphthyridine-4-carboxylic acid has a molecular weight of 189.17 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,8-naphthyridine-4-carboxylic acid is sourced from PubChem (CID 70580977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).