C9H10N2O4 — CID 102607093
3-amino-2-(oxetan-3-yloxy)pyridine-4-carboxylic acid (PubChem CID 102607093) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-amino-2-(oxetan-3-yloxy)pyridine-4-carboxylic acid.
| Compound Name | 3-amino-2-(oxetan-3-yloxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 102607093 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-amino-2-(oxetan-3-yloxy)pyridine-4-carboxylic acid |
| SMILES | Nc1c(C(=O)O)ccnc1OC1COC1 |
| InChI | InChI=1S/C9H10N2O4/c10-7-6(9(12)13)1-2-11-8(7)15-5-3-14-4-5/h1-2,5H,3-4,10H2,(H,12,13) |
| InChIKey | UFVMLIFRYQSZDP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |