C9H8ClNO3S — CID 107063804
3-chloro-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylic acid (PubChem CID 107063804) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is 3-chloro-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107063804 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 3-chloro-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(SC2COC2)c1Cl |
| InChI | InChI=1S/C9H8ClNO3S/c10-7-6(9(12)13)1-2-11-8(7)15-5-3-14-4-5/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | ONWWOFYBSUVZJQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |