C7H7ClN2O2S — CID 114791303
5-chloro-4-(oxetan-3-ylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 114791303) has the molecular formula C7H7ClN2O2S and a molecular weight of 218.66 g/mol. Its IUPAC name is 5-chloro-4-(oxetan-3-ylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(oxetan-3-ylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114791303 |
| Molecular Formula | C7H7ClN2O2S |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 5-chloro-4-(oxetan-3-ylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(SC2COC2)c1Cl |
| InChI | InChI=1S/C7H7ClN2O2S/c8-5-6(11)9-3-10-7(5)13-4-1-12-2-4/h3-4H,1-2H2,(H,9,10,11) |
| InChIKey | QGZXMJQTTAKWGW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |