C11H16N2Si — CID 176810006
trimethyl-(4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl)silane (PubChem CID 176810006) has the molecular formula C11H16N2Si and a molecular weight of 204.35 g/mol. Its IUPAC name is trimethyl-(4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl)silane.
| Compound Name | trimethyl-(4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl)silane |
|---|---|
| PubChem CID | 176810006 |
| Molecular Formula | C11H16N2Si |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | trimethyl-(4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl)silane |
| SMILES | Cc1nccc2[nH]c([Si](C)(C)C)cc12 |
| InChI | InChI=1S/C11H16N2Si/c1-8-9-7-11(14(2,3)4)13-10(9)5-6-12-8/h5-7,13H,1-4H3 |
| InChIKey | VQDVTOZRKZKQTC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|