C16H19NO2SSi — CID 102281917
ethyl 7-trimethylsilyl-6H-thieno[3,2-e]indole-2-carboxylate (PubChem CID 102281917) has the molecular formula C16H19NO2SSi and a molecular weight of 317.49 g/mol. Its IUPAC name is ethyl 7-trimethylsilyl-6H-thieno[3,2-e]indole-2-carboxylate.
| Compound Name | ethyl 7-trimethylsilyl-6H-thieno[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 102281917 |
| Molecular Formula | C16H19NO2SSi |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | ethyl 7-trimethylsilyl-6H-thieno[3,2-e]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccc3[nH]c([Si](C)(C)C)cc32)s1 |
| InChI | InChI=1S/C16H19NO2SSi/c1-5-19-16(18)14-8-11-10-9-15(21(2,3)4)17-12(10)6-7-13(11)20-14/h6-9,17H,5H2,1-4H3 |
| InChIKey | RCCJDWJMXFENOI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|